Biochemical Reagents
Filtered Search Results
| Regulatory Status | RUO |
|---|---|
| Conjugate | Unconjugated |
| Form | Liquid |
| Molecular Weight (g/mol) | 56.2 kDa |
| Formulation | 50% water with no preservative |
| For Use With (Application) | Control |
| Source | Human |
| Name | Human Activated Protein C (Dansyl-EGR-CK) |
| Conjugate | Unconjugated |
|---|---|
| Form | Liquid |
| Molecular Weight (g/mol) | 45.3 kDa |
| Common Name | Factor Xa |
| Gene Symbol | F10 |
| Activity | Specific Activity = 4955 U/mg |
| Storage Requirements | -20°C, Avoid Freeze/Thaw Cycles |
| Concentration | 3.3 mg/mL |
| For Use With (Application) | Bioactivity |
| Name | Bovine Factor Xa |
| Accession Number | P00743 |
| Regulatory Status | RUO |
| Purification Method | SDS-PAGE |
| Gene Alias | Activated factor Xa heavy chain; Coagulation factor X; F10; F10a; Factor X heavy chain; Factor X light chain; factor Xa; FX; FXA; prothrombinase; stuart factor; Stuart-Prower factor; Unknown (protein for IMAGE:8121240); unnamed protein product |
| Product Type | Protein |
| Gene ID (Entrez) | 280787 |
| Formulation | 50% water with 50% glycerol and no preservative |
| Regulatory Status | RUO |
|---|---|
| Form | Lyophilized |
| Product Type | Actin, from Rabbit Muscle |
| Formulation | Lyophilized powder |
| Storage Requirements | -30° to -10°C |
| For Use With (Application) | Cell Transport,Cell Transport |
| Source | Rabbit muscle |
| Recombinant | Native |
| Regulatory Status | RUO |
|---|---|
| Conjugate | Unconjugated |
| Form | Liquid |
| Molecular Weight (g/mol) | 46 kDa |
| Formulation | 50% water with no preservative |
| Concentration | 2.6 mg/mL |
| For Use With (Application) | Control |
| Source | Human |
| Name | Human Factor Xa (EGR) |
| Regulatory Status | RUO |
|---|---|
| Conjugate | Unconjugated |
| Form | Liquid |
| Molecular Weight (g/mol) | 55 kDa |
| Formulation | 50% water with 50% glycerol and no preservative |
| Concentration | 6.0 mg/mL |
| For Use With (Application) | Control |
| Source | Human |
| Name | Human Factor IX |
| Conjugate | Unconjugated |
|---|---|
| pH Range | 6.5 |
| Form | Liquid |
| Molecular Weight (g/mol) | 35.4 kDa |
| Common Name | beta-Thrombin |
| Gene Symbol | F2 |
| Storage Requirements | -80°C, Avoid Freeze/Thaw Cycles |
| Concentration | 2.3 mg/mL |
| For Use With (Application) | Neutralization |
| Name | Human beta-Thrombin |
| Accession Number | P00734 |
| Regulatory Status | RUO |
| Purification Method | SDS-PAGE |
| Gene Alias | Activation peptide fragment 1; Activation peptide fragment 2; Coagulation factor II; coagulation factor II (thrombin); coagulation factor II, thrombin; F2; prepro-coagulation factor II; prothrombin; prothrombin B-chain; PT; RPRGL2; serine protease; THPH1; Thrombin heavy chain; Thrombin light chain |
| Product Type | Protein |
| Gene ID (Entrez) | 2147 |
| Formulation | PBS with no preservative; pH 6.5 |
| Regulatory Status | RUO |
|---|---|
| Conjugate | Unconjugated |
| Form | Liquid |
| Molecular Weight (g/mol) | 260 kDa |
| Formulation | 25 mM sodium citrate with 0.1 M glycine, 0.1 M NaCl and no preservative; pH 6.8 |
| Concentration | 0.13 mg/mL |
| For Use With (Application) | Control |
| Source | Human |
| Name | Human vWF (Factor VIII Free) |
| Regulatory Status | RUO |
|---|---|
| Conjugate | Unconjugated |
| Form | Liquid |
| Molecular Weight (g/mol) | 44.859 kDa |
| Formulation | 50% water with 50% glycerol and no preservative |
| For Use With (Application) | Control |
| Source | Human |
| Name | Human beta-Factor Xa |
| Regulatory Status | RUO |
|---|---|
| Form | Solid |
| Product Type | Fibronectin-Binding Protein |
| Formulation | Lyophilized powder |
| Storage Requirements | -30° to -10°C |
| Recombinant | Native |
Thermo Scientific Chemicals Aprotinin, from Bovine Lung
Aprotinin (iniprol, CAS # 9087-70-1) is a single polypeptide chain from bovine tissues with antifibrinolytic activities.
| Regulatory Status | RUO |
|---|---|
| Form | Lyophilized |
| Product Type | Aprotinin, from Bovine Lung |
| Formulation | Lyophilized powder |
| Storage Requirements | 2° to 8°C |
| For Use With (Application) | Protease Inhibition |
| Source | Bovine lung |
| Recombinant | Native |
| Regulatory Status | RUO |
|---|---|
| Conjugate | Unconjugated |
| Form | Liquid |
| Molecular Weight (g/mol) | 12.9 kDa |
| Formulation | 50% water with 50% glycerol and no preservative |
| Concentration | 9.6 mg/mL |
| For Use With (Application) | Control |
| Source | Human |
| Name | Human Prothrombin (Factor II) Fragment 2 |
| Regulatory Status | RUO |
|---|---|
| Conjugate | Unconjugated |
| Form | Liquid |
| Molecular Weight (g/mol) | 46 kDa |
| Formulation | 50% water with no preservative; pH 7.4 |
| Concentration | 2.2 mg/mL |
| For Use With (Application) | Control |
| Source | Human |
| Name | Human Factor Xa (Dansyl-EGR) |
Thermo Scientific Chemicals Fluorescein, pure
CAS: 2321-07-5 Molecular Formula: C20H12O5 Molecular Weight (g/mol): 332.31 MDL Number: MFCD00005050 InChI Key: GNBHRKFJIUUOQI-UHFFFAOYSA-N PubChem CID: 16850 ChEBI: CHEBI:31624 IUPAC Name: 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one SMILES: C1=CC=C2C(=C1)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O
| PubChem CID | 16850 |
|---|---|
| CAS | 2321-07-5 |
| Molecular Weight (g/mol) | 332.31 |
| ChEBI | CHEBI:31624 |
| MDL Number | MFCD00005050 |
| SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
| IUPAC Name | 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChI Key | GNBHRKFJIUUOQI-UHFFFAOYSA-N |
| Molecular Formula | C20H12O5 |
Arsenazo II, free acid, >80%, MP Biomedicals™
CAS: 1668-00-4 Molecular Formula: C22H18As2N4O14S2 Molecular Weight (g/mol): 776.363 MDL Number: MFCD00036695 InChI Key: TVMZRHVOFZTNET-RIRMOVKSSA-N Synonym: 2,2'-[1, 8-dihydroxy-3,6-disulfo-2, 7-naphthalene-bis(azo)dibenzenearsonic acid,2, 2'-[1, 8-dihydroxy-3 PubChem CID: 9810878 IUPAC Name: (3Z,6E)-3,6-bis[(2-arsonophenyl)hydrazinylidene]-4,5-dioxonaphthalene-2,7-disulfonic acid SMILES: C1=CC=C(C(=C1)NN=C2C(=CC3=C(C2=O)C(=O)C(=NNC4=CC=CC=C4[As](=O)(O)O)C(=C3)S(=O)(=O)O)S(=O)(=O)O)[As](=O)(O)O
| PubChem CID | 9810878 |
|---|---|
| CAS | 1668-00-4 |
| Molecular Weight (g/mol) | 776.363 |
| MDL Number | MFCD00036695 |
| SMILES | C1=CC=C(C(=C1)NN=C2C(=CC3=C(C2=O)C(=O)C(=NNC4=CC=CC=C4[As](=O)(O)O)C(=C3)S(=O)(=O)O)S(=O)(=O)O)[As](=O)(O)O |
| Synonym | 2,2'-[1, 8-dihydroxy-3,6-disulfo-2, 7-naphthalene-bis(azo)dibenzenearsonic acid,2, 2'-[1, 8-dihydroxy-3 |
| IUPAC Name | (3Z,6E)-3,6-bis[(2-arsonophenyl)hydrazinylidene]-4,5-dioxonaphthalene-2,7-disulfonic acid |
| InChI Key | TVMZRHVOFZTNET-RIRMOVKSSA-N |
| Molecular Formula | C22H18As2N4O14S2 |